C20H23ClF3N5O5S — CID 158159915
2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetaldehyde (PubChem CID 158159915) has the molecular formula C20H23ClF3N5O5S and a molecular weight of 537.95 g/mol. Its IUPAC name is 2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158159915 |
| Molecular Formula | C20H23ClF3N5O5S |
| Molecular Weight | 537.95 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetaldehyde |
| SMILES | NC(N)=NOCCNC(=O)Cc1cc(NS(=O)(=O)Cc2ccccc2)ccc1Cl.O=CC(F)(F)F |
| InChI | InChI=1S/C18H22ClN5O4S.C2HF3O/c19-16-7-6-15(24-29(26,27)12-13-4-2-1-3-5-13)10-14(16)11-17(25)22-8-9-28-23-18(20)21;3-2(4,5)1-6/h1-7,10,24H,8-9,11-12H2,(H,22,25)(H4,20,21,23);1H |
| InChIKey | FWDJDFLOIOIONS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.95 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|