C17H21N5O4S — CID 10200467
2-[3-(benzenesulfonamido)phenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide (PubChem CID 10200467) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[3-(benzenesulfonamido)phenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide.
| Compound Name | 2-[3-(benzenesulfonamido)phenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
|---|---|
| PubChem CID | 10200467 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[3-(benzenesulfonamido)phenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
| SMILES | NC(N)=NOCCNC(=O)Cc1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H21N5O4S/c18-17(19)21-26-10-9-20-16(23)12-13-5-4-6-14(11-13)22-27(24,25)15-7-2-1-3-8-15/h1-8,11,22H,9-10,12H2,(H,20,23)(H4,18,19,21) |
| InChIKey | VYRGGCPQARBDSM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|