C19H26ClN5O4S — CID 159417417
2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;methane (PubChem CID 159417417) has the molecular formula C19H26ClN5O4S and a molecular weight of 455.97 g/mol. Its IUPAC name is 2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;methane.
| Compound Name | 2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;methane |
|---|---|
| PubChem CID | 159417417 |
| Molecular Formula | C19H26ClN5O4S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[5-(benzylsulfonylamino)-2-chlorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;methane |
| SMILES | C.NC(N)=NOCCNC(=O)Cc1cc(NS(=O)(=O)Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C18H22ClN5O4S.CH4/c19-16-7-6-15(24-29(26,27)12-13-4-2-1-3-5-13)10-14(16)11-17(25)22-8-9-28-23-18(20)21;/h1-7,10,24H,8-9,11-12H2,(H,22,25)(H4,20,21,23);1H4 |
| InChIKey | LPIHTHOHXFXFPC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|