C21H27ClN4O4S — CID 142133817
N-[2-(4-amino-4-iminobutoxy)ethyl]-2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetamide (PubChem CID 142133817) has the molecular formula C21H27ClN4O4S and a molecular weight of 466.99 g/mol. Its IUPAC name is N-[2-(4-amino-4-iminobutoxy)ethyl]-2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetamide.
| Compound Name | N-[2-(4-amino-4-iminobutoxy)ethyl]-2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetamide |
|---|---|
| PubChem CID | 142133817 |
| Molecular Formula | C21H27ClN4O4S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-[2-(4-amino-4-iminobutoxy)ethyl]-2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetamide |
| SMILES | [H]/N=C(\N)CCCOCCNC(=O)Cc1cc(NS(=O)(=O)Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C21H27ClN4O4S/c22-19-9-8-18(26-31(28,29)15-16-5-2-1-3-6-16)13-17(19)14-21(27)25-10-12-30-11-4-7-20(23)24/h1-3,5-6,8-9,13,26H,4,7,10-12,14-15H2,(H3,23,24)(H,25,27) |
| InChIKey | NXPCPPALTJSMHQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|