C28H38ClN5O8S — CID 87933764
tert-butyl N-[2-[[2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetyl]amino]ethoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 87933764) has the molecular formula C28H38ClN5O8S and a molecular weight of 640.16 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetyl]amino]ethoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetyl]amino]ethoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 87933764 |
| Molecular Formula | C28H38ClN5O8S |
| Molecular Weight | 640.16 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | tert-butyl N-[2-[[2-[5-(benzylsulfonylamino)-2-chlorophenyl]acetyl]amino]ethoxy]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)N(OCCNC(=O)Cc1cc(NS(=O)(=O)Cc2ccccc2)ccc1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38ClN5O8S/c1-27(2,3)41-25(36)32-24(30)34(26(37)42-28(4,5)6)40-15-14-31-23(35)17-20-16-21(12-13-22(20)29)33-43(38,39)18-19-10-8-7-9-11-19/h7-13,16,33H,14-15,17-18H2,1-6H3,(H,31,35)(H2,30,32,36) |
| InChIKey | VVSDEROPWVQZAF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 178.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|