C16H20N2O4S2 — CID 8513731
5-(benzylsulfonylamino)-N,N,2-trimethylbenzenesulfonamide (PubChem CID 8513731) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-(benzylsulfonylamino)-N,N,2-trimethylbenzenesulfonamide.
| Compound Name | 5-(benzylsulfonylamino)-N,N,2-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8513731 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-(benzylsulfonylamino)-N,N,2-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)Cc2ccccc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H20N2O4S2/c1-13-9-10-15(11-16(13)24(21,22)18(2)3)17-23(19,20)12-14-7-5-4-6-8-14/h4-11,17H,12H2,1-3H3 |
| InChIKey | BYLUWHRHKPEFNR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |