C16H17NO2S — CID 6457501
N-(2,3-dihydro-1H-inden-5-yl)-1-phenylmethanesulfonamide (PubChem CID 6457501) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-1-phenylmethanesulfonamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 6457501 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H17NO2S/c18-20(19,12-13-5-2-1-3-6-13)17-16-10-9-14-7-4-8-15(14)11-16/h1-3,5-6,9-11,17H,4,7-8,12H2 |
| InChIKey | ZDPOOGORTFXXIU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |