C16H17NO3S — CID 110726216
N-(3,4-dihydro-2H-chromen-6-yl)-1-phenylmethanesulfonamide (PubChem CID 110726216) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-6-yl)-1-phenylmethanesulfonamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-6-yl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 110726216 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-6-yl)-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C16H17NO3S/c18-21(19,12-13-5-2-1-3-6-13)17-15-8-9-16-14(11-15)7-4-10-20-16/h1-3,5-6,8-9,11,17H,4,7,10,12H2 |
| InChIKey | NUNOSSGDWYBMIF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |