C10H12ClNO4S — CID 55246773
1-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanesulfonamide (PubChem CID 55246773) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is 1-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanesulfonamide.
| Compound Name | 1-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanesulfonamide |
|---|---|
| PubChem CID | 55246773 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanesulfonamide |
| SMILES | O=S(=O)(CCl)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C10H12ClNO4S/c11-7-17(13,14)12-8-2-3-9-10(6-8)16-5-1-4-15-9/h2-3,6,12H,1,4-5,7H2 |
| InChIKey | YSNSQWBYMUYVLZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|