C9H10BrNO4S — CID 83092877
1-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide (PubChem CID 83092877) has the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. Its IUPAC name is 1-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide.
| Compound Name | 1-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide |
|---|---|
| PubChem CID | 83092877 |
| Molecular Formula | C9H10BrNO4S |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 1-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide |
| SMILES | O=S(=O)(CBr)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H10BrNO4S/c10-6-16(12,13)11-7-1-2-8-9(5-7)15-4-3-14-8/h1-2,5,11H,3-4,6H2 |
| InChIKey | ZWAVKKMXTGPLDS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|