C15H14N2O6S — CID 3751776
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2-nitrophenyl)methanesulfonamide (PubChem CID 3751776) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2-nitrophenyl)methanesulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 3751776 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2-nitrophenyl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1CS(=O)(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H14N2O6S/c18-17(19)13-4-2-1-3-11(13)10-24(20,21)16-12-5-6-14-15(9-12)23-8-7-22-14/h1-6,9,16H,7-8,10H2 |
| InChIKey | LWZHCWHJFVXGFF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|