C9H9F3N2O4S — CID 3734550
1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 3734550) has the molecular formula C9H9F3N2O4S and a molecular weight of 298.24 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide.
| Compound Name | 1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 3734550 |
| Molecular Formula | C9H9F3N2O4S |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1CS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O4S/c10-9(11,12)6-13-19(17,18)5-7-3-1-2-4-8(7)14(15)16/h1-4,13H,5-6H2 |
| InChIKey | IQHOGVWFSUVKJU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|