C9H11N3O5S — CID 64591767
2-[(2-nitrophenyl)methylsulfonylamino]acetamide (PubChem CID 64591767) has the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)methylsulfonylamino]acetamide.
| Compound Name | 2-[(2-nitrophenyl)methylsulfonylamino]acetamide |
|---|---|
| PubChem CID | 64591767 |
| Molecular Formula | C9H11N3O5S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-[(2-nitrophenyl)methylsulfonylamino]acetamide |
| SMILES | NC(=O)CNS(=O)(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O5S/c10-9(13)5-11-18(16,17)6-7-3-1-2-4-8(7)12(14)15/h1-4,11H,5-6H2,(H2,10,13) |
| InChIKey | UURAWAYHJNFADH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|