C9H11NO4S — CID 2788662
N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide (PubChem CID 2788662) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide |
|---|---|
| PubChem CID | 2788662 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H11NO4S/c1-15(11,12)10-7-2-3-8-9(6-7)14-5-4-13-8/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | AUBOIJRZDYWMPQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |