C11H16N2O4S — CID 110776719
7-(dimethylsulfamoylamino)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 110776719) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 7-(dimethylsulfamoylamino)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(dimethylsulfamoylamino)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 110776719 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 7-(dimethylsulfamoylamino)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C11H16N2O4S/c1-13(2)18(14,15)12-9-4-5-10-11(8-9)17-7-3-6-16-10/h4-5,8,12H,3,6-7H2,1-2H3 |
| InChIKey | KBPFPHPKSXYPTH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |