C16H15NO6S — CID 110758954
N-(1,3-benzodioxol-5-yl)-7-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 110758954) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-7-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-7-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 110758954 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-7-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | Cc1cc2c(cc1S(=O)(=O)Nc1ccc3c(c1)OCO3)OCCO2 |
| InChI | InChI=1S/C16H15NO6S/c1-10-6-13-15(21-5-4-20-13)8-16(10)24(18,19)17-11-2-3-12-14(7-11)23-9-22-12/h2-3,6-8,17H,4-5,9H2,1H3 |
| InChIKey | VTFKLSUFHCOXQX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|