C15H13NO6S — CID 8822258
3-(1,3-benzodioxol-5-ylsulfamoyl)-4-methylbenzoic acid (PubChem CID 8822258) has the molecular formula C15H13NO6S and a molecular weight of 335.34 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylsulfamoyl)-4-methylbenzoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-ylsulfamoyl)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 8822258 |
| Molecular Formula | C15H13NO6S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylsulfamoyl)-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13NO6S/c1-9-2-3-10(15(17)18)6-14(9)23(19,20)16-11-4-5-12-13(7-11)22-8-21-12/h2-7,16H,8H2,1H3,(H,17,18) |
| InChIKey | PTPOPAOAEVKMEH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |