C18H20N2O5S — CID 51121483
4-methyl-3-[(3-morpholin-4-ylphenyl)sulfamoyl]benzoic acid (PubChem CID 51121483) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 4-methyl-3-[(3-morpholin-4-ylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 4-methyl-3-[(3-morpholin-4-ylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 51121483 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-methyl-3-[(3-morpholin-4-ylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-13-5-6-14(18(21)22)11-17(13)26(23,24)19-15-3-2-4-16(12-15)20-7-9-25-10-8-20/h2-6,11-12,19H,7-10H2,1H3,(H,21,22) |
| InChIKey | SNBMYJKQJCTERF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_H(6)', 'substructure': 'N/A'} |
|---|