C20H17ClN2O6S2 — CID 24502076
3-[[3-[(3-chlorophenyl)sulfamoyl]phenyl]sulfamoyl]-4-methylbenzoic acid (PubChem CID 24502076) has the molecular formula C20H17ClN2O6S2 and a molecular weight of 480.95 g/mol. Its IUPAC name is 3-[[3-[(3-chlorophenyl)sulfamoyl]phenyl]sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[[3-[(3-chlorophenyl)sulfamoyl]phenyl]sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 24502076 |
| Molecular Formula | C20H17ClN2O6S2 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 3-[[3-[(3-chlorophenyl)sulfamoyl]phenyl]sulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H17ClN2O6S2/c1-13-8-9-14(20(24)25)10-19(13)31(28,29)23-17-6-3-7-18(12-17)30(26,27)22-16-5-2-4-15(21)11-16/h2-12,22-23H,1H3,(H,24,25) |
| InChIKey | OEEQDMAKJVPXFD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |