C18H22ClN3O3S — CID 119433918
3-[(3-chlorophenyl)sulfamoyl]-4-methyl-N-[3-(methylamino)propyl]benzamide (PubChem CID 119433918) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)sulfamoyl]-4-methyl-N-[3-(methylamino)propyl]benzamide.
| Compound Name | 3-[(3-chlorophenyl)sulfamoyl]-4-methyl-N-[3-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 119433918 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3-[(3-chlorophenyl)sulfamoyl]-4-methyl-N-[3-(methylamino)propyl]benzamide |
| SMILES | CNCCCNC(=O)c1ccc(C)c(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-13-7-8-14(18(23)21-10-4-9-20-2)11-17(13)26(24,25)22-16-6-3-5-15(19)12-16/h3,5-8,11-12,20,22H,4,9-10H2,1-2H3,(H,21,23) |
| InChIKey | DCNNWAIAYJFXTR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|