C21H24N4O3S — CID 37393533
4-methyl-3-[(3-methylphenyl)sulfamoyl]-N-(3-pyrazol-1-ylpropyl)benzamide (PubChem CID 37393533) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-methyl-3-[(3-methylphenyl)sulfamoyl]-N-(3-pyrazol-1-ylpropyl)benzamide.
| Compound Name | 4-methyl-3-[(3-methylphenyl)sulfamoyl]-N-(3-pyrazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 37393533 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-methyl-3-[(3-methylphenyl)sulfamoyl]-N-(3-pyrazol-1-ylpropyl)benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)NCCCn3cccn3)ccc2C)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-16-6-3-7-19(14-16)24-29(27,28)20-15-18(9-8-17(20)2)21(26)22-10-4-12-25-13-5-11-23-25/h3,5-9,11,13-15,24H,4,10,12H2,1-2H3,(H,22,26) |
| InChIKey | YCBVNVCIGALPSH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|