C21H18F2N2O3S — CID 3249145
N-(2,6-difluorophenyl)-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 3249145) has the molecular formula C21H18F2N2O3S and a molecular weight of 416.45 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(2,6-difluorophenyl)-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 3249145 |
| Molecular Formula | C21H18F2N2O3S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)Nc3c(F)cccc3F)ccc2C)c1 |
| InChI | InChI=1S/C21H18F2N2O3S/c1-13-5-3-6-16(11-13)25-29(27,28)19-12-15(10-9-14(19)2)21(26)24-20-17(22)7-4-8-18(20)23/h3-12,25H,1-2H3,(H,24,26) |
| InChIKey | PZNRKHLGJYXODW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |