C32H32N2O4S — CID 43885864
N-[3-(4-tert-butylbenzoyl)phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 43885864) has the molecular formula C32H32N2O4S and a molecular weight of 540.69 g/mol. Its IUPAC name is N-[3-(4-tert-butylbenzoyl)phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[3-(4-tert-butylbenzoyl)phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 43885864 |
| Molecular Formula | C32H32N2O4S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | N-[3-(4-tert-butylbenzoyl)phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)Nc3cccc(C(=O)c4ccc(C(C)(C)C)cc4)c3)ccc2C)c1 |
| InChI | InChI=1S/C32H32N2O4S/c1-21-8-6-11-28(18-21)34-39(37,38)29-20-25(13-12-22(29)2)31(36)33-27-10-7-9-24(19-27)30(35)23-14-16-26(17-15-23)32(3,4)5/h6-20,34H,1-5H3,(H,33,36) |
| InChIKey | ZQZXCZJIZZRBAV-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |