C28H25N3O4S — CID 55868933
N-(3-benzamidophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide (PubChem CID 55868933) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-(3-benzamidophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(3-benzamidophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 55868933 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-(3-benzamidophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(C(=O)Nc3cccc(NC(=O)c4ccccc4)c3)cc2)c1 |
| InChI | InChI=1S/C28H25N3O4S/c1-19-11-12-20(2)26(17-19)36(34,35)31-23-15-13-22(14-16-23)28(33)30-25-10-6-9-24(18-25)29-27(32)21-7-4-3-5-8-21/h3-18,31H,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | MBEBBHHJOOIJBK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |