C24H28N2O3S — CID 142804944
ethane;4-methyl-N-(2-methylphenyl)-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 142804944) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is ethane;4-methyl-N-(2-methylphenyl)-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | ethane;4-methyl-N-(2-methylphenyl)-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 142804944 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethane;4-methyl-N-(2-methylphenyl)-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | CC.Cc1cccc(NS(=O)(=O)c2cc(C(=O)Nc3ccccc3C)ccc2C)c1 |
| InChI | InChI=1S/C22H22N2O3S.C2H6/c1-15-7-6-9-19(13-15)24-28(26,27)21-14-18(12-11-17(21)3)22(25)23-20-10-5-4-8-16(20)2;1-2/h4-14,24H,1-3H3,(H,23,25);1-2H3 |
| InChIKey | OFIQPTBJOULVIN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |