C22H25ClN4O5S — CID 55596967
3-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-4-methyl-N-(3-pyrazol-1-ylpropyl)benzamide (PubChem CID 55596967) has the molecular formula C22H25ClN4O5S and a molecular weight of 492.99 g/mol. Its IUPAC name is 3-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-4-methyl-N-(3-pyrazol-1-ylpropyl)benzamide.
| Compound Name | 3-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-4-methyl-N-(3-pyrazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 55596967 |
| Molecular Formula | C22H25ClN4O5S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 3-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-4-methyl-N-(3-pyrazol-1-ylpropyl)benzamide |
| SMILES | COc1cc(OC)c(NS(=O)(=O)c2cc(C(=O)NCCCn3cccn3)ccc2C)cc1Cl |
| InChI | InChI=1S/C22H25ClN4O5S/c1-15-6-7-16(22(28)24-8-4-10-27-11-5-9-25-27)12-21(15)33(29,30)26-18-13-17(23)19(31-2)14-20(18)32-3/h5-7,9,11-14,26H,4,8,10H2,1-3H3,(H,24,28) |
| InChIKey | FBSJATLPGXVBAD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|