C18H24ClN3O3S — CID 119503479
3-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(methylamino)ethyl]benzamide;hydrochloride (PubChem CID 119503479) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(methylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 3-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119503479 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cccc(NS(=O)(=O)c2cc(C)ccc2C)c1.Cl |
| InChI | InChI=1S/C18H23N3O3S.ClH/c1-13-7-8-14(2)17(11-13)25(23,24)21-16-6-4-5-15(12-16)18(22)20-10-9-19-3;/h4-8,11-12,19,21H,9-10H2,1-3H3,(H,20,22);1H |
| InChIKey | DGQUNZQXGWBFAE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|