C16H14ClNO4S — CID 51121308
7-[(3-chlorophenyl)sulfamoyl]-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 51121308) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is 7-[(3-chlorophenyl)sulfamoyl]-2,3-dihydro-1H-indene-5-carboxylic acid.
| Compound Name | 7-[(3-chlorophenyl)sulfamoyl]-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|---|
| PubChem CID | 51121308 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 7-[(3-chlorophenyl)sulfamoyl]-2,3-dihydro-1H-indene-5-carboxylic acid |
| SMILES | O=C(O)c1cc2c(c(S(=O)(=O)Nc3cccc(Cl)c3)c1)CCC2 |
| InChI | InChI=1S/C16H14ClNO4S/c17-12-4-2-5-13(9-12)18-23(21,22)15-8-11(16(19)20)7-10-3-1-6-14(10)15/h2,4-5,7-9,18H,1,3,6H2,(H,19,20) |
| InChIKey | OQTKZODIHQDWNM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |