C15H11BrF3NO4S — CID 45291384
3-[[4-bromo-3-(trifluoromethyl)phenyl]sulfamoyl]-4-methylbenzoic acid (PubChem CID 45291384) has the molecular formula C15H11BrF3NO4S and a molecular weight of 438.22 g/mol. Its IUPAC name is 3-[[4-bromo-3-(trifluoromethyl)phenyl]sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[[4-bromo-3-(trifluoromethyl)phenyl]sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 45291384 |
| Molecular Formula | C15H11BrF3NO4S |
| Molecular Weight | 438.22 g/mol |
| Exact Mass | 436.95 |
| IUPAC Name | 3-[[4-bromo-3-(trifluoromethyl)phenyl]sulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11BrF3NO4S/c1-8-2-3-9(14(21)22)6-13(8)25(23,24)20-10-4-5-12(16)11(7-10)15(17,18)19/h2-7,20H,1H3,(H,21,22) |
| InChIKey | KMCQRPYVLUZSRQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |