C15H14BrNO4S — CID 78850990
3-bromo-4-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid (PubChem CID 78850990) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is 3-bromo-4-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 3-bromo-4-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 78850990 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 3-bromo-4-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)O)cc2Br)cc1C |
| InChI | InChI=1S/C15H14BrNO4S/c1-9-3-5-12(7-10(9)2)17-22(20,21)14-6-4-11(15(18)19)8-13(14)16/h3-8,17H,1-2H3,(H,18,19) |
| InChIKey | GBSCGZPOKRWLJE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |