C14H11BrClNO4S — CID 78851015
3-bromo-4-[(5-chloro-2-methylphenyl)sulfamoyl]benzoic acid (PubChem CID 78851015) has the molecular formula C14H11BrClNO4S and a molecular weight of 404.67 g/mol. Its IUPAC name is 3-bromo-4-[(5-chloro-2-methylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 3-bromo-4-[(5-chloro-2-methylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 78851015 |
| Molecular Formula | C14H11BrClNO4S |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 3-bromo-4-[(5-chloro-2-methylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C14H11BrClNO4S/c1-8-2-4-10(16)7-12(8)17-22(20,21)13-5-3-9(14(18)19)6-11(13)15/h2-7,17H,1H3,(H,18,19) |
| InChIKey | IZTOLASABUBWPU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |