C13H10BrCl2NO2S — CID 60661381
5-bromo-N-(2,5-dichlorophenyl)-2-methylbenzenesulfonamide (PubChem CID 60661381) has the molecular formula C13H10BrCl2NO2S and a molecular weight of 395.11 g/mol. Its IUPAC name is 5-bromo-N-(2,5-dichlorophenyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-bromo-N-(2,5-dichlorophenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60661381 |
| Molecular Formula | C13H10BrCl2NO2S |
| Molecular Weight | 395.11 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | 5-bromo-N-(2,5-dichlorophenyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H10BrCl2NO2S/c1-8-2-3-9(14)6-13(8)20(18,19)17-12-7-10(15)4-5-11(12)16/h2-7,17H,1H3 |
| InChIKey | UURCHEPJXKBBJW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.11 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |