C8H7BrF3NO2S — CID 3734435
N-[4-bromo-3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 3734435) has the molecular formula C8H7BrF3NO2S and a molecular weight of 318.11 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 3734435 |
| Molecular Formula | C8H7BrF3NO2S |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H7BrF3NO2S/c1-16(14,15)13-5-2-3-7(9)6(4-5)8(10,11)12/h2-4,13H,1H3 |
| InChIKey | UJSPTOTYUBYUCN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |