C16H15N3O6S — CID 9084706
5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methylbenzenesulfonamide (PubChem CID 9084706) has the molecular formula C16H15N3O6S and a molecular weight of 377.38 g/mol. Its IUPAC name is 5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9084706 |
| Molecular Formula | C16H15N3O6S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2ccc3c(c2)OCO3)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H15N3O6S/c1-9-2-3-11(7-14(9)26(17,22)23)16(21)19-18-15(20)10-4-5-12-13(6-10)25-8-24-12/h2-7H,8H2,1H3,(H,18,20)(H,19,21)(H2,17,22,23) |
| InChIKey | GTKHKVPXJWIUNQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|