C14H10F5N3O3S — CID 9089044
2-methyl-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide (PubChem CID 9089044) has the molecular formula C14H10F5N3O3S and a molecular weight of 395.31 g/mol. Its IUPAC name is 2-methyl-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide.
| Compound Name | 2-methyl-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9089044 |
| Molecular Formula | C14H10F5N3O3S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-methyl-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(=O)NNc2c(F)c(F)c(F)c(F)c2F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H10F5N3O3S/c1-5-2-3-6(4-7(5)26(20,24)25)14(23)22-21-13-11(18)9(16)8(15)10(17)12(13)19/h2-4,21H,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | BRIRKWPMSDGQAC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|