C16H16FN3O4S2 — CID 9091346
5-[[[2-(2-fluorophenyl)sulfanylacetyl]amino]carbamoyl]-2-methylbenzenesulfonamide (PubChem CID 9091346) has the molecular formula C16H16FN3O4S2 and a molecular weight of 397.45 g/mol. Its IUPAC name is 5-[[[2-(2-fluorophenyl)sulfanylacetyl]amino]carbamoyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-[[[2-(2-fluorophenyl)sulfanylacetyl]amino]carbamoyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9091346 |
| Molecular Formula | C16H16FN3O4S2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 5-[[[2-(2-fluorophenyl)sulfanylacetyl]amino]carbamoyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CSc2ccccc2F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H16FN3O4S2/c1-10-6-7-11(8-14(10)26(18,23)24)16(22)20-19-15(21)9-25-13-5-3-2-4-12(13)17/h2-8H,9H2,1H3,(H,19,21)(H,20,22)(H2,18,23,24) |
| InChIKey | JBEAPWRWQKHZRM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|