C19H22FN3O4S2 — CID 24641233
N-[3-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 24641233) has the molecular formula C19H22FN3O4S2 and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[3-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[3-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24641233 |
| Molecular Formula | C19H22FN3O4S2 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[3-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCC(=O)NNC(=O)CSc2ccccc2F)c1 |
| InChI | InChI=1S/C19H22FN3O4S2/c1-13-7-8-14(2)17(11-13)29(26,27)21-10-9-18(24)22-23-19(25)12-28-16-6-4-3-5-15(16)20/h3-8,11,21H,9-10,12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | PSPCWNQDXJZFJE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|