C18H19F4N3O3S — CID 166182254
N-[3-[2-[2-fluoro-5-(trifluoromethyl)phenyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 166182254) has the molecular formula C18H19F4N3O3S and a molecular weight of 433.43 g/mol. Its IUPAC name is N-[3-[2-[2-fluoro-5-(trifluoromethyl)phenyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[3-[2-[2-fluoro-5-(trifluoromethyl)phenyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 166182254 |
| Molecular Formula | C18H19F4N3O3S |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[3-[2-[2-fluoro-5-(trifluoromethyl)phenyl]hydrazinyl]-3-oxopropyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCC(=O)NNc2cc(C(F)(F)F)ccc2F)c1 |
| InChI | InChI=1S/C18H19F4N3O3S/c1-11-3-4-12(2)16(9-11)29(27,28)23-8-7-17(26)25-24-15-10-13(18(20,21)22)5-6-14(15)19/h3-6,9-10,23-24H,7-8H2,1-2H3,(H,25,26) |
| InChIKey | QQQFMVPIOIYRAK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|