C17H18F2N2O3S — CID 26500090
3-[(3,4-difluorophenyl)sulfonylamino]-N-(2,5-dimethylphenyl)propanamide (PubChem CID 26500090) has the molecular formula C17H18F2N2O3S and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)sulfonylamino]-N-(2,5-dimethylphenyl)propanamide.
| Compound Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 26500090 |
| Molecular Formula | C17H18F2N2O3S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-(2,5-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCNS(=O)(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H18F2N2O3S/c1-11-3-4-12(2)16(9-11)21-17(22)7-8-20-25(23,24)13-5-6-14(18)15(19)10-13/h3-6,9-10,20H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | HGYDILBQBZKQMZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |