C15H15FN4O3S2 — CID 9085389
1-(4-fluorophenyl)-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea (PubChem CID 9085389) has the molecular formula C15H15FN4O3S2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 9085389 |
| Molecular Formula | C15H15FN4O3S2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea |
| SMILES | Cc1ccc(C(=O)NNC(=S)Nc2ccc(F)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H15FN4O3S2/c1-9-2-3-10(8-13(9)25(17,22)23)14(21)19-20-15(24)18-12-6-4-11(16)5-7-12/h2-8H,1H3,(H,19,21)(H2,17,22,23)(H2,18,20,24) |
| InChIKey | CTEKDQIRIHRFBG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|