C17H20N4O4S2 — CID 9086024
1-[(4-methoxyphenyl)methyl]-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea (PubChem CID 9086024) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 9086024 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[(4-methyl-3-sulfamoylbenzoyl)amino]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)c2ccc(C)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H20N4O4S2/c1-11-3-6-13(9-15(11)27(18,23)24)16(22)20-21-17(26)19-10-12-4-7-14(25-2)8-5-12/h3-9H,10H2,1-2H3,(H,20,22)(H2,18,23,24)(H2,19,21,26) |
| InChIKey | QHIFEOALILLLJM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|