C24H24N4O4S2 — CID 6218192
1-[(4-methoxyphenyl)methyl]-3-[[3-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea (PubChem CID 6218192) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[[3-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[[3-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 6218192 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[[3-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)c2cccc(NS(=O)(=O)/C=C/c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-32-22-12-10-19(11-13-22)17-25-24(33)27-26-23(29)20-8-5-9-21(16-20)28-34(30,31)15-14-18-6-3-2-4-7-18/h2-16,28H,17H2,1H3,(H,26,29)(H2,25,27,33)/b15-14+ |
| InChIKey | AITCGNWNYQGTSO-CCEZHUSRSA-N |
| XLogP | 3.42 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|