C13H13N3O4S2 — CID 9085464
2-methyl-5-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 9085464) has the molecular formula C13H13N3O4S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-methyl-5-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | 2-methyl-5-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9085464 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-methyl-5-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2cccs2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H13N3O4S2/c1-8-4-5-9(7-11(8)22(14,19)20)12(17)15-16-13(18)10-3-2-6-21-10/h2-7H,1H3,(H,15,17)(H,16,18)(H2,14,19,20) |
| InChIKey | HDCUEKSDNLXGIT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|