C13H11N3O4S — CID 3316001
N'-(4-methyl-3-nitrobenzoyl)thiophene-2-carbohydrazide (PubChem CID 3316001) has the molecular formula C13H11N3O4S and a molecular weight of 305.31 g/mol. Its IUPAC name is N'-(4-methyl-3-nitrobenzoyl)thiophene-2-carbohydrazide.
| Compound Name | N'-(4-methyl-3-nitrobenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3316001 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N'-(4-methyl-3-nitrobenzoyl)thiophene-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2cccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11N3O4S/c1-8-4-5-9(7-10(8)16(19)20)12(17)14-15-13(18)11-3-2-6-21-11/h2-7H,1H3,(H,14,17)(H,15,18) |
| InChIKey | DVDTUAAXUYGURG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|