C19H16N4O4S2 — CID 90526947
N-[5-(4-methyl-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide (PubChem CID 90526947) has the molecular formula C19H16N4O4S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[5-(4-methyl-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-(4-methyl-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 90526947 |
| Molecular Formula | C19H16N4O4S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[5-(4-methyl-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCc3nc(NC(=O)c4cccs4)sc3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O4S2/c1-11-4-5-12(9-14(11)23(26)27)18(25)22-7-6-13-16(10-22)29-19(20-13)21-17(24)15-3-2-8-28-15/h2-5,8-9H,6-7,10H2,1H3,(H,20,21,24) |
| InChIKey | YVDWVXOSDZKKQJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|