C18H16N4O5S3 — CID 90527270
N-[5-(2-methyl-5-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide (PubChem CID 90527270) has the molecular formula C18H16N4O5S3 and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[5-(2-methyl-5-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-(2-methyl-5-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 90527270 |
| Molecular Formula | C18H16N4O5S3 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | N-[5-(2-methyl-5-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCc2nc(NC(=O)c3cccs3)sc2C1 |
| InChI | InChI=1S/C18H16N4O5S3/c1-11-4-5-12(22(24)25)9-16(11)30(26,27)21-7-6-13-15(10-21)29-18(19-13)20-17(23)14-3-2-8-28-14/h2-5,8-9H,6-7,10H2,1H3,(H,19,20,23) |
| InChIKey | UHKHZKNJNVUPIZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|