C14H14N4O5S2 — CID 90525406
N-[5-(3-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]acetamide (PubChem CID 90525406) has the molecular formula C14H14N4O5S2 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[5-(3-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]acetamide.
| Compound Name | N-[5-(3-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]acetamide |
|---|---|
| PubChem CID | 90525406 |
| Molecular Formula | C14H14N4O5S2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-[5-(3-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(s1)CN(S(=O)(=O)c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C14H14N4O5S2/c1-9(19)15-14-16-12-5-6-17(8-13(12)24-14)25(22,23)11-4-2-3-10(7-11)18(20)21/h2-4,7H,5-6,8H2,1H3,(H,15,16,19) |
| InChIKey | KFWZFBJUFZKDMS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|