C15H16N4O6S2 — CID 90528197
ethyl N-[5-(2-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]carbamate (PubChem CID 90528197) has the molecular formula C15H16N4O6S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is ethyl N-[5-(2-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]carbamate.
| Compound Name | ethyl N-[5-(2-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 90528197 |
| Molecular Formula | C15H16N4O6S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | ethyl N-[5-(2-nitrophenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc2c(s1)CN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C15H16N4O6S2/c1-2-25-15(20)17-14-16-10-7-8-18(9-12(10)26-14)27(23,24)13-6-4-3-5-11(13)19(21)22/h3-6H,2,7-9H2,1H3,(H,16,17,20) |
| InChIKey | AEPHLDOTMLXKFR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|