C19H20ClN5O4S — CID 90529355
1-[5-(4-chloro-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-cyclopentylurea (PubChem CID 90529355) has the molecular formula C19H20ClN5O4S and a molecular weight of 449.92 g/mol. Its IUPAC name is 1-[5-(4-chloro-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-cyclopentylurea.
| Compound Name | 1-[5-(4-chloro-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 90529355 |
| Molecular Formula | C19H20ClN5O4S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1-[5-(4-chloro-3-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-cyclopentylurea |
| SMILES | O=C(Nc1nc2c(s1)CN(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)CC2)NC1CCCC1 |
| InChI | InChI=1S/C19H20ClN5O4S/c20-13-6-5-11(9-15(13)25(28)29)17(26)24-8-7-14-16(10-24)30-19(22-14)23-18(27)21-12-3-1-2-4-12/h5-6,9,12H,1-4,7-8,10H2,(H2,21,22,23,27) |
| InChIKey | SXYBFJGGEOMNHR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|