C16H14N2O6S — CID 8662268
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate (PubChem CID 8662268) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 8662268 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
| SMILES | Cc1ccc(C(=O)COC(=O)CNC(=O)c2cccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N2O6S/c1-10-4-5-11(7-12(10)18(22)23)13(19)9-24-15(20)8-17-16(21)14-3-2-6-25-14/h2-7H,8-9H2,1H3,(H,17,21) |
| InChIKey | UDCYIJVEYOTPKT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|